![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | Personal Web Page.htm | 03-Jul-2012 10:48 | 30K | |
![[TXT]](/icons/text.gif) | Publications.html | 03-Jul-2012 10:48 | 13K | |
![[TXT]](/icons/text.gif) | Research Interests.html | 03-Jul-2012 10:48 | 5.9K | |
![[TXT]](/icons/text.gif) | Research Interests2.html | 13-Jul-2012 16:41 | 11K | |
![[DIR]](/icons/folder.gif) | Research Interests2_files/ | 04-Jan-2007 00:00 | - | |
![[TXT]](/icons/text.gif) | TOCFrame.htm | 03-Jul-2012 10:48 | 6.5K | |
![[IMG]](/icons/image2.gif) | Takita3.JPG | 03-Jul-2012 10:48 | 89K | |
![[ ]](/icons/unknown.gif) | WS_FTP.LOG | 03-Jul-2012 10:48 | 11K | |
![[IMG]](/icons/image2.gif) | at hook dna region.jpg | 03-Jul-2012 10:48 | 192K | |
![[TXT]](/icons/text.gif) | biochemistry and molecular biology links.htm | 03-Jul-2012 10:48 | 6.2K | |
![[IMG]](/icons/image2.gif) | biomedsum05poster03.jpe | 03-Jul-2012 10:48 | 27K | |
![[IMG]](/icons/image2.gif) | biomedsum05poster17.jpe | 03-Jul-2012 10:48 | 39K | |
![[TXT]](/icons/text.gif) | default.htm | 03-Jul-2012 10:48 | 2.7K | |
![[TXT]](/icons/text.gif) | sumter.html | 07-Jul-2012 15:24 | 13K | |
![[TXT]](/icons/text.gif) | sumter.html.old | 03-Jul-2012 10:48 | 14K | |
![[DIR]](/icons/folder.gif) | sumter_files/ | 04-Jan-2007 00:00 | - | |
![[TXT]](/icons/text.gif) | takita.html | 03-Jul-2012 10:48 | 2.7K | |
![[TXT]](/icons/text.gif) | ~$blications.html | 03-Jul-2012 10:48 | 162 | |
![[TXT]](/icons/text.gif) | ~$ochemistry and molecular biology links.htm | 03-Jul-2012 10:48 | 162 | |
![[TXT]](/icons/text.gif) | ~$ourses.html | 03-Jul-2012 10:48 | 162 | |
![[TXT]](/icons/text.gif) | ~$search Interests.html | 03-Jul-2012 10:48 | 162 | |
|